Physics, 07.05.2020 07:00 jair512872

The Franck-Hertz experiment involved shooting electrons into a low-density gas of mercury atoms and observing discrete amounts of kinetic energy loss by the electrons. Suppose instead a similar experiment is done with a very cold gas of atomic hydrogen, so that all of the hydrogen atoms are initially in the ground state. If the kinetic energy of an electron is 11.1 eV just before it collides with a hydrogen atom, how much kinetic energy will the electron have just after it collides with and excites the hydrogen atom? Kfinal = eV

Answers: 2

Show answers

Answers

Answer from: MAKYERAHWILLIAMS09

the final kinetic energy is 0.9eV

Explanation:

To find the kinetic energy of the electron just after the collision with hydrogen atoms you take into account that the energy of the electron in the hydrogen atoms are given by the expression:

$E_n=\frac{-13.6eV}{n^2}$

you can assume that the shot electron excites the electron of the hydrogen atom to the first excited state, that is

$E_{n_2-n_1}=-13.6eV[\frac{1}{n_2^2}-\frac{1}{n_1^2}]\\\\E_{2-1}=-13.6eV[\frac{1}{2^2}-\frac{1}{1}]=-10.2eV$

-10.2eV is the energy that the shot electron losses in the excitation of the electron of the hydrogen atom. Hence, the final kinetic energy of the shot electron after it has given -10.2eV of its energy is:

$E_{k}=11.1eV-10.2eV=0.9eV$

Answer from: Quest

answer: the answer is a

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 01:30

Ablock of mass 1.5 kg slides down an inclined plane that has an angle of 15. if the inclined plane has no friction and the block starts at a height of 3 m, how much kinetic energy does the block have when it reaches the bottom? acceleration due to gravity is g = 9.8 m/s2. a. 6.8 j b. 50.9 j c. 0 j d. 44.1 j

Answers: 1

Answer

Physics, 22.06.2019 02:30

What are the factors that affect the resistance of a wire?

Answers: 1

Answer

Physics, 22.06.2019 04:50

Find v(t), given acceleration a(t)=7j and initial velocity v(0)=k

Answers: 2

Answer

Physics, 22.06.2019 06:20

Atwo-stage air compressor operates at steady state, compression 10m^3/min of air from 100 kpa and 300k to 1200 kpa. an intercooler between the two stages cools the air to 300k at a constant pressure of 350 kpa. the compression processes are isentropic. a) calculate the power required to run the compressor, in kw b) compare the result to the power required for isentropic compression from the same inlet state to the same final pressure.

Answers: 1

Answer

You know the right answer?

The Franck-Hertz experiment involved shooting electrons into a low-density gas of mercury atoms and...

Questions