You're driving down the highway late one night at 16.0 m/s when a deer steps onto the road 39.0 m in front of you. your reaction time before stepping on the breaks is 0.50 s, and the maximum deceleration of your car is 12.0 m/s2 . how much distance is in between you and the deer when you come to a stop? what is the maximum speed you could have and still not hit the dear?

The breaking distance consists of two parts. The first part is the first 0.5 seconds were no breaking occurs. Given values: t time, v₀ initial velocity:
x₁ = v₀*t
The second part occurs after t = 0,5s with the given acceleration: a = - 12 m/s²
were the final velocity is zero, v = 0 and the initial velocity v₀= 16m/s:
v = a*t + v₀ = 0 => v₀ = -a*t => t = v₀/-a

x₂ = 0.5*a*t² = 0.5*v°²/a

The total breaking distance is the sum of the two parts:
x = x₁ + x₂ = v₀* t + 0.5 * v₀² / a = 16 * 0.5 + 0.5 * 16² / 12 = 8 + 10,7 = 18,7

You can use this result to calculate the remaining distance. You can use the last equation to calculate the maximum speed you could have to avoid a collision.
Use x = 39m and solve for v₀. 

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o