Aray of light strikes a smooth surface and is reflected. the angle of incidence is 35°. what can be predicted about the angle of reflection? rays will bounce in all directions, so the angle of reflection will be random. rays will bounce in all directions, so the angle of reflection will be less than 35°. rays will follow the law of reflection, so the angle of reflection will be 35°. rays will follow the law of reflection, so the

Rays will follow the law of reflection, so the angle of reflection will be 35 degrees. If a light ray strikes a smooth surface, the reflected ray will bounce off the surface with the same angle the ray hits the surface. In other words, the angle of incidence is the same of angle of reflection, which is 35 degrees. If the surface is not smooth, the reflected ray might diffuse in all directions.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o