How to find the velocity of an object in a circular path?

First of all, let's just talk about the speed, and not get wound up
in the velocity. OK ?

If a fly is sitting on the rim of the wheel and the wheel is rotating, then for
each full revolution of the wheel, the fly travels the circumference of the
wheel, which is (2 π) x (radius of the wheel).

In 'N' revolutions, the fly travels (2 N π) x (the radius). and so on.

So if the wheel is going, let's say 71 revs per minute (RPM), a point
on the rim is moving at (2 π times 71) x (the radius) per minute.

Another way to say it:

Speed of a point on the circle = (2 π) x (rotation frequency) x (radius).

The 'rotation frequency' takes care of the unit of time, and the 'radius'
takes care of the unit of length, so the result is a speed.

Distance of an object in a circular path is equal to the circumference of the circular path, so the formula to find speed is -

 Speed = 
Speed is there because velocity keeps changing continuously, because of the change of direction.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Definitely the indoraptor