Lab 7b conservation of energy what limits how much a system may change?

So far the only form of energy that we defined was kinetic energy which is a function of velocity squared (or speed squared) K = 1 2 mv2 . (7.1) It turns out that it is also useful to define another form of energy which is a function of position. This new physical quantity we will call potential energy. The process of storing potential energy would most certainly require work to be done on the object, but later on the potential energy can be released. The most familiar example of potential energy is the gravitational potential energy, when the work must be done on an object to lift it up. For example, if on object has mass m and is lifted from height x1 to height x2, then the work done by gravitational force is Wgrav = ! −mgˆi " !(x2 − x1) ˆi " = mgx1 − mgx2 (7.2) Then it is convenient to define a gravitational potential energy Ugrav ≡ mgx (7.3) and then the work done by gravitational force can be written as Wgrav = −∆Ugrav = Ugrav,1 − Ugrav,2. (7.4)

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o