Physics, 22.08.2019 12:30 Nicolas9979

Why does the same side of the moon always face the earth?

Answers: 1

Show answers

Answers

Because the moon takes exactly precisely the same time to rotate once on its axis as it takes to revolve once in its orbit around the Earth.

Answer from: Quest

i think it’s a. this is because if they measured the mass of something with a mass of 150g, then their final answer would have to be approximately 150g. though all of their answers are almost 150, rosa and tran have the closest answers (or the exact answer) to the accurate one.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 00:00

Explain to someone who knows nothing about fossils the study of invertebrate paleontology and how it scientists understand the history of the earth. be sure your explanation contains a minimum of two complete sentences.

Answers: 2

Answer

Physics, 22.06.2019 00:10

A-of 75 cm by cm by 17.5 cm up. of is 2 kg a , in ,if it is in , kg/?

Answers: 1

Answer

Physics, 22.06.2019 02:00

Jasmine is diving off a 3-meter springboard. her height in meters above the water when she is x meters horizontally from the end of the board is approximated by the equation h=-x^2+3x+3. what is the maximum height jasmine will reach on her dive?

Answers: 3

Answer

Physics, 22.06.2019 17:00

Since the energy was not raising the temperature of the water during these segments, what was the energy used to do instead? your answer must include an explanation of what is happening to the molecules.