Physics, 03.12.2021 19:10 lareynademividp0a99r

If the electric current at point # 1 is 0.8 A, then what is the electric current at point # 2 along the wire? What is the electric current at point # 3 along the wire?

What is the voltage (electric potential difference) across resistor # 1?

What is the voltage (electric potential difference) across resistor # 2?

What is the resistance across resistor # 1?

What is the resistance across resistor # 2?

If the electric current at point # 1 is 0.8 A, then what is the electric current at point # 2 along

Answers: 1

Show answers

Answers

Answer from: Quest

the gas collects in coils that then becomes a liquid that then flows through the coils inside the refrigerator

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

i just did an experiment like this in my science class. also the answer is yes, it will get separated because they are two opposites meaning if they are opposite they can not attract.

hope this .!

Answer from: Quest

the answer would most likely be c, because if it's a comical piece of information, it may likely not be true, if it's a site that allows anybody to edit the content, it could mean a five year old is typing the info, and if it's a tv show produced by a celeb, it may have a biased opinion.

Another question on Physics

Physics, 22.06.2019 12:00

If the new moon happens on january 15th, what shape will it be on february 6th?

Answers: 1

Answer

Physics, 22.06.2019 13:20

Ahanging spring stretches by 35.0 cm when an object of mass 450 g is hung on it at rest. in this situation, we define its position as x = 0. the object is pulled down an additional 18.0 cm and released from rest to oscillate without friction. what is its position x at a moment 84.4 s later? express your answer in cm.

Answers: 1

Answer

Physics, 22.06.2019 19:40

Uranium has two naturally occurring isotopes. 238u has a natural abundance of 99.3% and 235u has an abundance of 0.7%. it is the rarer 235u that is needed for nuclear reactors. the isotopes are separated by forming uranium hexafluoride uf6, which is a gas, then allowing it to diffuse through a series of porous membranes. 235uf6 has a slightly larger rms speed than 238uf6 and diffuses slightly faster. many repetitions of this procedure gradually separate the two isotopes. what is the ratio of the rms speed of 235uf6 to that of 238uf6? express your answer to five significant figures.

Answers: 3

Answer

Physics, 23.06.2019 13:30

A6.5-g iron meteor hits the earth at a speed of 295 m/s. if its kinetic energy is entirely converted to heat in the meteor, by how much will its temperature rise? the specific heat of iron is 113 cal/kg ∙ c°, and 1 cal = 4.186 j. a) 57,100 c° b)384 c° c)0.147 c° d)92.0 c°

Answers: 1

Answer

You know the right answer?

If the electric current at point # 1 is 0.8 A, then what is the electric current at point # 2 along...

Questions