Physics, 16.08.2021 23:10 Hudman57

calculate the mass of potassium chlorate (kcio3) required to obtain 10g of oxygen in the following reaction:kclO3-kcl+O2

Answers: 2

Show answers

Answers

Answer from: markyyy53

First, balance the reaction:

_ KClO₃ ==> _ KCl + _ O₂

As is, there are 3 O's on the left and 2 O's on the right, so there needs to be a 2:3 ratio of KClO₃ to O₂. Then there are 2 K's and 2 Cl's among the reactants, so we have a 1:1 ratio of KClO₃ to KCl :

2 KClO₃ ==> 2 KCl + 3 O₂

Since we start with a known quantity of O₂, let's divide each coefficient by 3.

2/3 KClO₃ ==> 2/3 KCl + O₂

Next, look up the molar masses of each element involved:

• K: 39.0983 g/mol

• Cl: 35.453 g/mol

• O: 15.999 g/mol

Convert 10 g of O₂ to moles:

(10 g) / (31.998 g/mol) ≈ 0.31252 mol

The balanced reaction shows that we need 2/3 mol KClO₃ for every mole of O₂. So to produce 10 g of O₂, we need

(2/3 (mol KClO₃)/(mol O₂)) × (0.31252 mol O₂) ≈ 0.20835 mol KClO₃

KClO₃ has a total molar mass of about 122.549 g/mol. Then the reaction requires a mass of

(0.20835 mol) × (122.549 g/mol) ≈ 25.532 g

of KClO₃.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Distance^2= yellow line ^2 (see picture) = 30^2 + 49^2so distance = squareroot of (300^2 +49^2)i dont know if this is how to solve it, but i cnt think of another way

Another question on Physics

Physics, 22.06.2019 04:00

Acompound machine is also called a machine. a. force b. simple c. complex d. directional

Answers: 1

Answer

Physics, 22.06.2019 05:00

Aperson standing in a canoe exerts a force of 700 n to throw an anchor over the side. find the acceleration of the canoe if the total mass of the canoe and the person is 100 kg?

Answers: 1

Answer

Physics, 22.06.2019 08:40

Apulley system is used to lift a 2,000 newton engine up a distance of 3 meters. the operator must apply a force of 250 newtons to the chain of the pulley system to lift the motor. to lift the engine 3 meters, the operator must pull a total of 30 meters of chain through the pulley system. what is the value of di?

Answers: 1

Answer

Physics, 22.06.2019 09:00

When a bicycle coasts uphill, it moves slower and slower as it climbs. why? a. its kinetic energy is transforming into heat energy. b. its potential energy is transforming into kinetic energy. c. its kinetic energy is transforming into potential energy and heat energy. d. its potential energy is transforming into kinetic energy and heat energy.

Answers: 1

Answer

You know the right answer?

calculate the mass of potassium chlorate (kcio3) required to obtain 10g of oxygen in the following r...

Questions