Physics, 05.08.2021 14:00 vannah94

How much charge is stored on two parallel-plate capacitors by the 12V battery if one is filled with air and the other is filled with a dielectric (k=3.00)

Answers: 2

Show answers

Answers

Answer from: ricesonice5

The question is incomplete, the complete question is;

how much charge is stored on the parallel-plate capacitors by the 12.0 V battery? One is filled with air, and the other is filled with a dielectric for which k = 3.00; both capacitors have a plate area of 5.00×10 −3 m 2 and a plate separation of 2.00 mm.

The capacitance of the capacitor is the quantity of charge stored by the capacitor.

Given that;

C1= εo k * A/d

εo = permittivity of free space

C1 = 8.85 x 10-12 farad per meter *1 * 5.00×10 −3 m 2/2 * 10^-3

= 2.21 * 10^-11 F

C2 = 8.85 x 10-12 * 3 * 5.00×10 −3 m 2/2 * 10^-3

= 6.63 * 10^-11 F

q1 = C1V1 = 2.21 * 10^-11 C * 12 V

= 2.65 * 10^-10 C

q2 = C2V2 = 6.63 * 10^-11 F * 12 V

= 7.96 * 10^-10 C

qtotal = 2.65 * 10^-10 C + 7.96 * 10^-10 C

qtotal = 1.061 * 10^-9C

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

reserve is the answer

Another question on Physics

Physics, 21.06.2019 16:00

Apiano tuner uses a tuner to create a tone of 5.00 x 10² hz. when a key on the piano is struck he hears 5 beats per second. what is a possible frequency of vibration for the piano string? 2500 hz 1300 hz 605 hz 495 hz

Answers: 1

Answer

Physics, 21.06.2019 23:20

Asmall, positively charged ball is moved close to a large, positively charged ball. which describes how the small ball likely responds when it is released? it will move toward the large ball because like charges repel. it will move toward the large ball because like charges attract. it will move away from the large ball because like charges repel. it will move away from the large ball because like charges attract.

Answers: 3

Answer

Physics, 22.06.2019 03:00

Which object is most likely represented by a dot?

Answers: 1

Answer

Physics, 22.06.2019 05:50

High schoolphysics 5+3 pts a neon light consists of a glass tube with metal wires at each end. when connected to a high-voltage source, the gas glows. if a fly lands on the glass tube, what will most likely happen? a) the fly will not feel a shock because the glass conducts any free electrons back into the gas. b) electrons will flow directly from the metal wires along the glass and shock the fly. c) the fly will not feel a shock because the glass insulates it from the electrons in the gas and the metal. d) electrons that are moving through the gas will be conducted through the glass and shock the fly.

Answers: 3

Answer

You know the right answer?

How much charge is stored on two parallel-plate capacitors by the 12V battery if one is filled with...

Questions