Physics, 11.05.2021 21:50 Dianar723

!! How much voltage is needed to generate a current of 20 Amps if a line has a resistance of 10 ohms ? How much power does the appliance from question number one give off ? If the appliance runs for 3 minutes , how much energy is used ? Please help me

Answers: 3

Show answers

Answers

Answer from: sdavenport84

Power = 4000watts

Energy = 22.22Joules

Explanation:

Power = I²R

I is the current

R is the resistance

t is the time

Given the following

I = 20Amps

R = 10ohms

t = 3miuntes = 180secs

Substitute

P = 20²*10

P = 400*10

P = 4000Watts

Hence the amount of power used is 4000Watts

Energy used = Power/time

Energy used= 4000/180

Energy used = 22.22Joules

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

force required to detach it is given by

$f = 4 * 10^{-8} n$

charges are taken to be fundamental charge

$q_1 = q_2 = 1.6 * 10^{-19}c$

now we have

$f = \frac{kq_1q_2}{r^2}$

$4 * 10^{-8} = \frac{9*10^9 * 1.6*10^{-19}* 1.6* 10^{-19}}{r^2}$

$r = 7.6 * 10^{-11} m$

so above is the minimum distance at which it will detach

Another question on Physics

Physics, 22.06.2019 00:00

1134567 a jet with mass m = 1.1 ă— 105 kg jet accelerates down the runway for takeoff at 2 m/s2. 1) what is the net horizontal force on the airplane as it accelerates for takeoff? 2.2*10^5 n your submissions: 2.2*10^5 computed value: 220000submitted: saturday, january 26 at 2: 41 pm feedback: correct! 2) what is the net vertical force on the airplane as it accelerates for takeoff? 0 n your submissions: 0 computed value: 0submitted: saturday, january 26 at 2: 41 pm feedback: correct! 3) once off the ground, the plane climbs upward for 20 seconds. during this time, the vertical speed increases from zero to 21 m/s, while the horizontal speed increases from 80 m/s to 95 m/s. what is the net horizontal force on the airplane as it climbs upward? n 4) what is the net vertical force on the airplane as it climbs upward? n 5) after reaching cruising altitude, the plane levels off, keeping the horizontal speed constant, but smoothly reducing the vertical speed to zero, in 13 seconds. what is the net horizontal force on the airplane as it levels off? n 6) what is the net vertical force on the airplane as it levels off?

Answers: 1

Answer

Physics, 22.06.2019 10:00

(a) calculate the number of electrons in a small, electrically neutral silver pin that has a mass of 10.0 g. silver has 47 electrons per atom, and its molar mass is 107.87 g/mol. (b) imagine adding electrons to the pin until the negative charge has the very large value 1.00 mc. how many electrons are added for every 109 electrons already present

Answers: 3

Answer

Physics, 22.06.2019 12:30

Write a full page that sumerizes thermodynamics it’s from the website visionlearnig

Answers: 1

Answer

Physics, 22.06.2019 13:00

What effects result when there is an impact between earth and an asteroid? check all that apply. a.massive flooding. b.extinction of many life forms.c.major earthquakes change in average global temperature.d. giant dust cloud

Answers: 3

Answer

You know the right answer?

!! How much voltage is needed to generate a current of 20 Amps if a line has a resistance of 10 ohms...

Questions

Physics, 24.10.2020 02:30

See attached, thanks !! ...