Explain the range of effectiveness of each fundamental force by describing the distance that each force influence nearby matter gravitational force , electromagnetic force, strong force, and weak force

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Answertraveling around a circular trackexplanation"traveling around a circular track" is the best answer as you could be traveling around a circular track at a constant speed. your velocity would therefore have the same magnitude but will always be constantly direction. since acceleration is the rate of change of velocity, the rate of change will only involve the direction of velocity and not the magnitude.wrong choices: "an object at rest" does not accelerate at all"increasing speed while traveling around a curve" means that the acceleration will not be constant due to only change in direction; it will be constant due to both magnitude and direction"an object in free fall" does not necessarily change direction