Atrain moving at a constant speed of 55.0 km/h moves east for 35.0 min, then in a direction 55.0° east of due north for 10.0 min, and then west for 45.0 min. what is the average velocity of the train during this run? (let the +x-axis point towards the east and the +y-axis point towards the north.)

When you illustrate the problem description, the direction of distance travelled is shown in the picture. But actually, since you are asked of the average velocity, you really don't need the drawing. It is given that the constant speed is 55 km/h. Since distance is speed multiplied with time, then you only have to multiply the constant speed and the respective time so you can find the distance. The average velocity, on the other hand, is the total distance per total time travelled. So since there is a constant speed, all the terms for time will be cancelled. Therefore, the average velocity is the constant speed. But we have to add the direction, which is south so it will denote a negative sign. The final answer for average velocity is -55 km/h.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o