Albert is on earth and measures the speed of light from the sun as 3 e8 m/s. he then gets in a space ship and speeds toward the sun at 1 x e8 m/s. he will then measure the speed of light as

The speed of light is a constant. This is the fundamental rule in relativity theory. So as crazy as it seems, the light would still be measured at 3e8m/s.
This speed is given by the reciprocal of the square root of the product of two universal constants. Since these constants do not change based on your frame of reference, the speed of light in vacuum cannot change either. This is why funny things start to happen with time and space as the relative velocity of two frames of reference approaches the speed of light.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o