Engineers and science fiction writers have proposed designing space stations in the shape of a rotating wheel or ring, which would allow astronauts to experience a sort of artificial gravity when walking along the inner wall of the station's outer rim. (a) Imagine one such station with a diameter of 103 m, where the apparent gravity is 3.60 m/s2 at the outer rim. How fast is the station rotating in revolutions per minute

Efficiency is an action of doing something. for example when you take a test. good efficiency means you did well but bad effeciency or no effiency means you did bad.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

If there was no gravity then their would be no downword force on the football to have it return the the grownd, and if there was no friction (mainly air friction) then there would be no opposing force the stop the ball from moving through the air allowing the ball to travle ∞.