Physics, 25.02.2021 16:00 19cmulett

What is the magnetic flux density if the force on a wire is 5N, the length of the wire is 0.4m and the current through it is 0.5A?

Answers: 2

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

as we know our atmosphere or air have different levels. every level has other gasses, and every gas has another permeability. when the light comes from lower permeability to higher permeability, it changes its direction. so that means that when the light comes from the moon to the earth, it changes it's direction many more times. it basically means that the shape of the light part of the moon is changed on the earth.

hope this ! this is not copied! search it up, it's free of plagiarism!

Answer from: Quest

Iisisisisososos9soslslsskosisosisi

Answer from: Quest

Inelastic is the answer your looking for.

Another question on Physics

Physics, 22.06.2019 17:30

Asilver dollar is dropped from the top of a building that is 1324 feet tall. use the position function below for free-falling objects. s(t) = −16t2 + v0t + s0 (a) determine the position and velocity functions for the coin. s(t) = v(t) = (b) determine the average velocity on the interval [1, 2]. ft/s (c) find the instantaneous velocities when t = 1 second and t = 2 seconds. v(1) = ft/s v(2) = ft/s (d) find the time required for the coin to reach the ground level. (round your answer to three decimal places.) t = s (e) find the velocity of the coin at impact. (round your answer to three decimal places.) ft/s

Answers: 3

Answer

Physics, 22.06.2019 19:20

Which best describes the difference between internal and thermal energy?

Answers: 1

Answer

Physics, 22.06.2019 23:00

How much energy will be transferred to your eardrum while listening to this sound for 1.0 min?

Answers: 1

Answer

Physics, 23.06.2019 00:00

Boiling water is an example of physical change. true or false