*A car is going through a dip in the road whose curvature approximates a circle of radius 150m. At what velocity will the occupants of the car appear to weigh 15% more than their normal weight

v= 14.85 m/s

Explanation:

When at the bottom of the dip, the only force that keeps the car in the circular trajectory, is the centripetal force.This force is not a new force, is just the net force aiming to the center of the circle.In this case, is just the difference between the normal force (always perpendicular to the surface, pointing upward) and the force that gravity exerts on the car (which is known as the weight), pointing downward.So, we can write the following expression:

       

It can be showed that the centripetal force is related to the speed by the following expression:The normal force, it is called the apparent weight, because it would be the weight as measured by a scale.Replacing (2) in (1), and solving for Fn, we get:

       

Now, we need to find the value of v that makes Fn, exactly 15% more than the weight m*g, so we can write the following equation:

     

Replacing Fg by its value, simplifying, and solving for v, we get:

       

Arise 8 run 1 this means go 8 up and 1 across, which is steepest

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o