Ihave these questions i need to find the acceleration, explain how to do them, don't have to explain all xd

1. change in speed = 14 m/s; time taken = 2 seconds. calculate the acceleration.

2. a car accelerates from rest (zero speed) up to a speed of 30 m/s in 12 seconds. calculate the acceleration.

3. a cyclist in the tour de france accelerates down a hill from 22 m/s to a speed of 37 m/s. this acceleration takes him 2 seconds. calculate the acceleration.

4. a rocket launching in the ukraine accelerates upwards from rest to a speed of 12 km/s in 8 seconds. calculate the acceleration.

5. a cyclist accelerates from 0 m/s to 8 m/s in 3 seconds. what is his acceleration ? is this acceleration higher than that of a car which accelerates from 0 to 30 m/s in 8 seconds?

6. a car advertisement states that a certain car can accelerate from rest to 70 km/h in 7 seconds. find the car’s average acceleration.

7. a lizard accelerates from 2 m/s to 10 m/s in 4 seconds. what is the lizard’s average acceleration?

8. if a ferrari, with an initial velocity of 10 m/s, accelerates at a rate of 50 m/s2 for 3 seconds, what will its final velocity be?

1. a=(v-v0)/t
a=14 m/s / 2s
a=7 m/s^2
2. a=(v-v0)/t
a=(30 m/s - 0 m/s) / 12 s
a=2.5 m/s^2
3. a=(v-v0)/t
a=(37 m/s - 22 m/s) / 2 s
a= 7.5 m/s^2
4. a=(v-v0)/t
a=(12 km/s - 0 km/s)/8 s
a=1.5 km/s^2
etc

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Ithink the answer is d i hope it my friend message me if i’m wrong and i’ll change my answer and fix it for you