Physics, 03.11.2020 06:00 jesusmejia383

A 3,000 kg truck moving at +10 m/s hits a 1,000 kg parked car which moves off at +15 m/s What is the velocity of the truck after the collision

Answers: 1

Show answers

Answers

Answer from: amay1977

v₃ = 5 [m/s]

Explanation:

To solve this problem we must use the definition of linear momentum, which tells us that momentum is equal to the product of mass by Velocity.

P = m*v

where:

P = linear momentum [kg*m/s]

m = mass [kg]

v = velocity [m/s]

We must also clarify that the momentum is preserved i.e. it is equal before the collision and after the collision

Pbeforecollision = Paftercollision

(m₁*v₁) + (m₂*v₂) = (m₁*v₃) + (m₂*v₄)

where:

m₁ = mass of the truck = 3000 [kg]

v₁ = velocity of the truck = 10 [m/s]

m₂ = mass of the car = 1000 [kg]

v₂ = velocity of the car before the collision = 0 (the car is parked)

v₃ = velocity of the truck after the collision [m/s]

v₄ = velocity of the car after the collision = 15 [m/s]

(3000*10) + (1000*0) = (3000*v₃) + (1000*15)

30000 = 3000*v₃ + 15000

3000*v₃ = 30000 - 15000

3000*v₃ = 15000

v₃ = 5 [m/s]

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the motion of a pendulum is a classic example of mechanical energy conservation. a pendulum consists of a mass (known as a bob ) attached by a string to a pivot point. as the pendulum moves it sweeps out a circular arc, moving back and forth in a periodic fashion.

How does a pendulum model an energy conversation system?

Another question on Physics

Physics, 21.06.2019 22:30

Select the word from the list that best fits the definition classification of most stars on the h-r diagram

Answers: 1

Answer

Physics, 22.06.2019 07:30

Automobile fuel efficiency is often measured in miles that the car can be driven per gallon of fuel (mpg). heavier cars tend to have lower fuel efficiencies (lower mpg ratings). which variable (weight or fuel efficiency) is most naturally considered the explanatory (predictor) variable in this context?

Answers: 3

Answer

Physics, 22.06.2019 08:30

Hey student studies gravity using objects that have the same mass which two objects have the greatest gravitational force acting between them a. 100kg 1.0m 100kg b. 100kg 2.0m 100kg c. 100kg 2.0m 100kg big d. 100kg big 3.0m 100kg big

Answers: 1

Answer

Physics, 22.06.2019 13:50

The magnitude of the poynting vector of a planar electromagnetic wave has an average value of 0.939 w/m^2 . the wave is incident upon a rectangular area, 1.5 m by 2.0 m, at right angles. how much total electromagnetic energy falls on the area during 1.0 minute?

Answers: 2

Answer

You know the right answer?

A 3,000 kg truck moving at +10 m/s hits a 1,000 kg parked car which moves off at +15 m/s What is the...

Questions