Physics, 25.09.2020 22:01 peytontanner

Write the following numbers in scientific notation 1. 0.000000199
2. 24,070
3. 590
4. 0.00308
5. 0.000500
write the following in standard notation
6. 2.105 x 10^6
7. 1.99 x 10^4
8. 7.006 x 10^-3
9. 4.11 x 10^-5
10. 5.03 x 10^2

Answers: 3

Show answers

Answers

Answer from: Quest

hi there!

your question asks at which segment does freezing occur.

since we're talking about water, the freezing point of water will be 32 degrees fahrenheit or below.

hope this ! ~

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

Wish i knew this to !

Answer from: Quest

note: the given question is incomplete.

complete question is given below.

which is an example of kinetic energy?

a. the energy stored in ethanol

b. a hockey puck sliding across the ice

c. a compressed spring

d. a ball sitting at the top of a ramp

solution: the kinetic energy is the energy posses by the virtue of the motion of the object.

in the given options, a, c and d are the example of potential energy because it is the energy posses by the virtue of the rest of the object. but option b has the kinetic energy as the object is in motion.

hence, a hockey puck sliding across the ice is the apex example of kinetic energy.

so, the option (b) a hockey puck sliding across the ice is the correct option.

Another question on Physics

Physics, 21.06.2019 21:30

How many seconds does it take a pebble released from rest off a bridge to fall 29.4 m ? what is the pebble's speed when it has fallen 29.4 m ?

Answers: 1

Answer

Physics, 21.06.2019 22:00

Air is held within a frictionless piston-cylinder container, which is oriented vertically. the mass of the piston is 0.45 kg and the cross-sectional area is 0.0030 m2. initially (state 1) the pressure of the gas is sufficient to support the weight of the piston as well as the force exerted by the atmospheric pressure ( 101.32 kpa). the volume occupied by the air within the cylinder in state 1 is 1.00 liter. one end of a spring (with spring constant k = 1000 n/m) is attached to the top of the piston, while the other end of the spring is attached to a stage that can move vertically. initially the spring is undeflected and therefore exerts no force. then the stage is then moved quasistatically downward a distance of 10.0 cm, at which point the system reaches state 2. the piston-cylinder is not insulated; rather it remains in diathermal contact with the surroundings, which are at a constant temperature of 300 k. what is the change of pressure within the container?

Answers: 3

Answer

Physics, 21.06.2019 23:30

After a big snowfall, you take your favorite rocket-powered sled out to a wide field. the field is 195 m across, and you know that your sled accelerates at a rate of 3.65 m/s2 when the rocket is on. how much time will it take the sled to cross the field starting from rest, assuming the rocket is on the whole time?

Answers: 1

Answer

Physics, 22.06.2019 06:30

How much force was applied to an object if was moved 2 meters and the work done on the object was 8 joules? a. 0.25 n b. 4 n c. 6 n d. 16 n

Answers: 1

Answer

You know the right answer?

Write the following numbers in scientific notation 1. 0.000000199
2. 24,070
3. 590

Questions