Physics, 02.09.2020 18:01 lippj0228

A student throws a heavy red ball horizontally from a balcony of a tall building with an initial speed v0. At the same time, a second student drops a lighter blue ball from the same balcony. Neglecting air resistance, which statement is true?

Answers: 1

Show answers

Answers

Answer from: TheRunningPotatoe245

The correct statement must be: both balls hit the floor at the same time

Explanation:

This is a kinematics exercise. The ball thrown horizontally does not have vertical speed and the ball that is released does not have vertical speed, therefore both take the same time to reach the ground, if we neglect the air resistance

The correct statement must be: both balls hit the floor at the same time

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

0 = 0.40 / 0 = 0

= 0.20 = 9.80 ⁄2 =?

=0 , = = 0.20 =0.50 0 0.40 ⁄

=0−122 =0−12(9.80 ⁄2)(0.50)2 =1.2

Another question on Physics

Physics, 21.06.2019 16:10

Write short note on the following ; collision theory, rotation angle and angular velocity, centripetal acceleration, coriolis force, and newton's law of gravitation.

Answers: 2

Answer

Physics, 22.06.2019 05:30

Will give brainliest! which statement best describes the difference between strong nuclear forces and weak nuclear forces? weak nuclear forces are involved when certain types of atoms break down. strong nuclear forces are responsible for holding atoms' nucleus together. weak nuclear forces hold bonds between atoms together. strong nuclear forces hold together the nucleus of an atom. strong nuclear bonds prevent atoms from falling apart. weak nuclear bonds prevent compounds from falling apart. strong nuclear forces are involved in breaking electrons from their shells. weak nuclear forces hold protons in the nucleus.

Answers: 3

Answer

Physics, 22.06.2019 22:00

If anyonee has done the momentum lab practical in physics can you give me the answers i am s lostt rnn : (

Answers: 2

Answer

Physics, 22.06.2019 22:00

Four friends, a, b, c, and d are standing varying distances away from a speaker which is producing sound waves.

Answers: 2

Answer

You know the right answer?

A student throws a heavy red ball horizontally from a balcony of a tall building with an initial spe...