Physics, 26.07.2020 20:01 davidaagurto

Why does fire has not any shadow?

Answers: 2

Show answers

Answers

Answer from: Quest

a solenoid is created by wrapping a l = 90 m long wire around a hollow tube of diameter d = 4.5 cm. the wire diameter is d = 0.9 mm. the solenoid wire is then connected to a power supply so that a current of i = 9 a flows through the wire.

randomized variablesl = 90 m

d = 4.5 cm

d = 0.9 mm

i = 9 a

write an expression for the number of turns, n, in the solenoid. you do not need to take into account the diameter of the wire in this calculation.

calculate the number of turns, n, in the solenoid.

write an expression for the length of the solenoid (l2) in terms of the diameter of the hollow tube d.

calculate the length of the solenoid (l2) in meters.

calculate the magnitude of the magnetic field at the center of the solenoid in teslas.

explanation:

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

iron would move it is magnetic there is a mag field around the current in the wire

Answer from: Quest

If there was no gravity then their would be no downword force on the football to have it return the the grownd, and if there was no friction (mainly air friction) then there would be no opposing force the stop the ball from moving through the air allowing the ball to travle ∞.

Another question on Physics

Physics, 22.06.2019 07:30

Write the function getkthdigit(n, k) that takes a possibly-negative int n and a non-negative int k, and returns the kth digit of n, starting from 0, counting from the right

Answers: 3

Answer

Physics, 22.06.2019 16:50

Consider the growth of a 20-nm-diameter silicon nanowire onto a silicon wafer. the temperature of the wafer surface is maintained at 2400 k. assume the thermal conductivity of the silicon nanowire is 20 wm-1k-1 and all its surfaces including the tip are subjected to convection heat transfer with the coefficient h = 1×105 wm-2k-1 and t∞ = 8000 k. when the nanowire grows to l = 300 nm, what is the temperature of the nanowire tip (t (x =

Answers: 1

Answer

Physics, 22.06.2019 22:40

Calculate the volume of this regular solid. what is the volume of the cone? round your answer to the nearest hundredth

Answers: 1

Answer

Physics, 23.06.2019 08:00

How are elastic and inelastic collisions different? give two or more ways. your answer should have at least 2 sentences.