Physics, 12.06.2020 03:57 mithydizon1553

1. Calculate the total binding energy of 12 6 C.

Answer in units of MeV.

2. Calculate the average binding energy per nucleon of 24

12Mg.

Answer in units of MeV/nucleon.

3. Calculate the average binding energy per nucleon of 85

37Rb.

Answer in units of MeV/nucleon.

4. Find the binding energy per nucleon of 238

92U.

Answer in units of MeV/nucleon.

5. Calculate the total binding energy of 20

10Ne.

Answer in units of MeV.

6. Calculate the total binding energy of 40

20Ca.

Answer in units of MeV.

Answers: 3

Show answers

Answers

Answer from: ErickP1686

1. B = 79.12 MeV

2. B = -4.39 MeV/nucleon

3. B = 2.40 MeV/nucleon

4. B = 7.48 MeV/nucleon

5. B = -18.72 MeV

6. B = 225.23 MeV

Explanation:

The binding energy can be calculated using the followng equation:

$B = (Zm_{p} + Nm_{n} - M)*931 MeV/C^{2}$

Where:

Z: is the number of protons

$m_{p}$ : is the proton's mass = 1.00730 u

N: is the number of neutrons

$m_{n}$ : is the neutron's mass = 1.00869 u

M: is the mass of the nucleus

1. The total binding energy of $^{12}_{6}C$ is:

$B = (Zm_{p} + Nm_{n} - M)*931.49 MeV/u$

B = (6*1.00730 + 6*1.00869 - 12.011)*931.49 MeV/u = 79.12 MeV

2. The average binding energy per nucleon of $^{24}_{12}Mg$ is:

$B = \frac{(Zm_{p} + Nm_{n} - M)}{A}*931.49 MeV/u$

Where: A = Z + N

$B = \frac{(12*1.00730 + 12*1.00869 - 24.305)}{(12 + 12)}*931.49 MeV/u = -4.39 MeV/nucleon$

3. The average binding energy per nucleon of $^{85}_{37}Rb$ is:

$B = \frac{(Zm_{p} + Nm_{n} - M)}{A}*931.49 MeV/u$

$B = \frac{(37*1.00730 + 48*1.00869 - 85.468)}{85}*931.49 MeV/u = 2.40 MeV/nucleon$

4. The binding energy per nucleon of $^{238}_{92}U$ is:

$B = \frac{(92*1.00730 + 146*1.00869 - 238.03)}{238}*931.49 MeV/u = 7.48 MeV/nucleon$

5. The total binding energy of $^{20}_{10}Ne$ is:

$B = (Zm_{p} + Nm_{n} - M)*931.49 MeV/u$

B = (10*1.00730 + 10*1.00869 - 20.180)*931.49 MeV/u = -18.72 MeV

6. The total binding energy of $^{40}_{20}Ca$ is:

$B = (Zm_{p} + Nm_{n} - M)*931.49 MeV/u$

B = (20*1.00730 + 20*1.00869 - 40.078)*931.49 MeV/u = 225.23 MeV

I hope it helps you!

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the assestment will probley apele with cause and effect

Another question on Physics

Physics, 21.06.2019 20:30

Which statement best describes how private industry decides where to spend the money on research and development

Answers: 1

Answer

Physics, 22.06.2019 12:30

Brades exam guidelines exam instructions billing & payments & support question 6 of 20 : select the best answer for the question use this illustration to answer the question below. forms & resources al programs 9 ww linics 6. in the circuit shown in the figure above, suppose that the value of r, is 100k, and the value of r2 is 470 kq. at which of the following locations in the circuit would you measure the highest voltage with your meter? rvices 999999 a. between points b and c b. between points a and b c. between points b and e d. between points a and c eredu mark for review (will be highlighted on the review page) mend < < previous question next question

Answers: 1

Answer

Physics, 22.06.2019 16:00

While the change in blank will remain the same during a collision, the force needed to bring an object to a stop can be blank if the time if collision is blank

Answers: 1

Answer

Physics, 22.06.2019 17:10

Which statement best describes the superposition principle? a.) if two in-phase waves arrive simultaneously at a point, their amplitudes add up b.) if two out-of-phase waves arrive simultaneously at a point, their amplitudes add up c.) if two in-phase waves arrive at a point one after another, their amplitudes add up d.) if two out-of-phase waves arrive at a point one after another, their amplitudes adds up

Answers: 2

Answer

You know the right answer?

1. Calculate the total binding energy of 12 6 C.

Answer in units of MeV.

2....

Questions

Physics, 02.10.2020 22:01

How are rockets made?...