Which statement best compares potential and kinetic energy? .
a) objects always have more potential energy than kinetic energy..
b)only kinetic energy increases when the velocity of an object increases.
c)only potential energy decreases when an object’s height increases..
d)objects always have more kinetic energy than potential energ

The statement that best compares potential and kinetic energy would be : B. only kinetic energy increases when velocity of an object increases

Formula in calculating kinetic energy is : 1/2 m v^2.
which mean as velocity increased, the kinetic energy would be larger

hope this helps

Which statement best compares potential and kinetic energy?

Out of all the options shown above the one that represents the statement that best compares potential and kinetic energy is answer choice B) Only kinetic energy increases when the velocity of an object increases. The reason being that kinetic energy is the energy of any object in motion while potential energy is the stored energy.

I hope it helps, Regards.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o