Physics, 19.05.2020 16:21 amiechap12

The density of dry air at 20 degrees celsius is 1.20 g/L. What is the mass of air, in kilograms, of a room that measures 24.0m by 15.0 m by 4.0 m

Answers: 2

Show answers

Answers

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

The speed was not exceeded so it was slow

Answer from: Quest

Apossible long term health effects of stress would be work

Answer from: Quest

as we know our atmosphere or air have different levels. every level has other gasses, and every gas has another permeability. when the light comes from lower permeability to higher permeability, it changes its direction. so that means that when the light comes from the moon to the earth, it changes it's direction many more times. it basically means that the shape of the light part of the moon is changed on the earth.

hope this ! this is not copied! search it up, it's free of plagiarism!

Another question on Physics

Physics, 23.06.2019 00:40

Researchers conducted an experiment to identify the effects of three different hand sanitizers on the growth of bacteria. the researchers grew one type of bacteria in twenty-four identical covered petri dishes. then, they opened eighteen petri dishes and applied the three hand sanitizers to six petri dishes each. they left the remaining six petri dishes closed as a control group. when the researchers measured the growth of bacteria two days later, the six dishes that had no hand sanitizer showed the least amount of bacterial growth. the researchers concluded that not using any hand sanitizer would lead to the least bacterial growth. which statement best explains why the researchers’ conclusion was not justified? the experiment tested too many variables. the control group was not treated the same as the experimental group. the sample size of twenty-four petri dishes is not large enough. the single type of bacteria is not adequate to make any conclusions.

Answers: 1

Answer

Physics, 23.06.2019 01:20

What is the state of matter with a specific volume but no definite shape

Answers: 1

Answer

Physics, 23.06.2019 02:40

An impulse is the product of the on an object and time during which it is applied

Answers: 2

Answer

Physics, 23.06.2019 03:30

Aspring that is stretched 2.6 cm stores a potential energy of 0.053 j. what is the spring constant of this spring?