1. Which type of wire would be a better conductor of an electrical current?

a. Short, fat, cold wire

b. Long, thin, warm wire

2. As the collisions between electrons and protons increase, the electrical current will

a. increase

b. decrease

3. Which change will cause an increase in the resistance of conductivity?

a. Changing from a long wire to a shorter wire.

b. Sunlight heating up a wire.

c. Exchanging a thin wire for a much thicker wire.

Thanks for the help! <3

1. a

2. b

3. b

Explanation:

1.

Resistance is the property of a conductor to offer resistance to the flow of current. The lower the resistance better is  the conductivity of wire.

We know that the resistance of a wire depends on several factor which are inter-connected by an equation as:

where:

R = resistance of the wire

length of the wire

cross sectional area of the wire  

from the above relation we observe that

Also when the temperature of the wire is significantly high then the lattice vibration cause obstruction in the path of the flowing charges and reduce the current flow.

2.

As the collision between the electrons and protons increases the speed of the flow of charges will decrease because the opposite charges attract each other and as we know that electrical current is the rate of flow of charge.

3.

Heating up of wire due to sunlight will cause lattice vibration in the conductor and will obstruct the movement of the charges which build up electric current, hence increasing the resistance of conductivity.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o