Suppose you are on a cart, initially at rest, which rides on a frictionless horizontal track. You throw a ball at a vertical surface that is firmly attached to the cart. If the ball bounces straight back as shown in the picture, will the cart be put into motion after the ball bounces back from the surface?
A. Yes, and it moves to the right.
B. Yes, and it moves to the left.
C. No, it remains in place

And the forces are equal but in the opposite direction. So then we can write by general rule:

Or equivalently:

Where: represent the speed of the car and the speed of the ball

represent the mass of the car

represent the mass of the ball

Since the ball is moving to the left and we assume that the total momentum not changes then the car need to move to the right in order to satisfy the equation and satisfy the balance.

By conservation of the momentum the car will move to the right since the ball is moves to the left.

So then the correct option for this case is :

A.Yes, and it moves to the right.

Explanation:

If we assume that we have the situation in the figure attached.

For this case we assume that the momentum changes are equal in magnitude and opposite in direction, so then we satisfy this:

And the forces are equal but in the opposite direction. So then we can write by general rule:

Or equivalently:

Where: represent the speed of the car and the speed of the ball

represent the mass of the car

represent the mass of the ball

Since the ball is moving to the left and we assume that the total momentum not changes then the car need to move to the right in order to satisfy the equation and satisfy the balance.

By conservation of the momentum the car will move to the right since the ball is moves to the left.

So then the correct option for this case is :

A.Yes, and it moves to the right.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o

Rain is pulled by gravity which is a non contact force