Physics, 24.02.2020 19:04 Spoilmom7231

{WILL GIVE (Brain lies t) TO FULL ANSWERS}
1. What factor affects the color of a star?
2. What type of star has a high temperature but a low luminosity?
3. Most of the stars on the HR program are classified as which type of star?
4. How is it possible for white dwarfs to have a lower luminosity than the sun even though the sun is cooler than white dwarfs?
5. What type of star has a low temperature but a high luminosity

{WILL GIVE (Brain lies t) TO FULL ANSWERS} 1. What factor affects the color of a star? 2. What type

Answers: 1

Show answers

Answers

Answer from: KOAL

1: surface temperature

2: red giant

3: The brightest stars are called supergiants. Star clusters are rich in stars just off the main sequence called red giants. Main sequence stars are called dwarfs.

4: A white dwarf is very dense

5: red giant

plz mark me as brainliest :)

Answer from: pillgiing

1. Their temperature and luminascity

2. The sun

3. Main sequence (im not sure of the answer tho)

4. Because of the color the white dwarfs are white and the sun in and orange/red color

5. Blue giants

~I hope this helps! Peace :D

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the assestment will probley apele with cause and effect

Another question on Physics

Physics, 22.06.2019 05:20

A3.9 g aluminum foil ball with a charge of +4.1×10−9 c is suspended on a string in a uniform horizontal e⃗ field. the string deviates to the right and makes an angle of 30∘ with the vertical. part a part complete what information about the e⃗ field can you determine for this situation? what information about the field can you determine for this situation? only the magnitude of e⃗ only the direction of e⃗ both the magnitude and the direction of e⃗ none of the above previous answers correct part b determine the magnitude of the electric field. express your answer with the appropriate units. e e = nothing nothing request answer part c determine the direction of the electric field. determine the direction of the electric field. to the right to the left away from you toward you

Answers: 3

Answer

Physics, 22.06.2019 08:20

The two required components for a generator are

Answers: 3

Answer

Physics, 22.06.2019 11:00

Which of the following are guidelines to follow for obtaining accurate observations

Answers: 2

Answer

Physics, 22.06.2019 23:30

How is the ideal mechanical advantage of a wheel and axle calculated?