Physics, 19.02.2020 19:29 jenniferboanno62

In making the determination that bullets, shells, or cartridge cases were fired from a specific weapon, the criminalist would use which piece of laboratory equipment?

Answers: 1

Show answers

Answers

Answer from: shashi2728

Comparison Microscope

Explanation:

The Comparison Microscope allows for comparison between two objects or samples by placing them side by side.

It is primarily used in criminology for ballistics which makes it ideal to find out if bullets, shells, or cartridge cases were fired from a specific weapon.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

the answer would most likely be c, because if it's a comical piece of information, it may likely not be true, if it's a site that allows anybody to edit the content, it could mean a five year old is typing the info, and if it's a tv show produced by a celeb, it may have a biased opinion.

Another question on Physics

Physics, 22.06.2019 15:00

10 points! will mark brainiest! in a heat engine if 1,000 j of heat enters the system and the piston does 500 j of work, what is the final internal energy of the system if the initial energy was 2,000 j 1: write the equation2: list out your known variables 3: plug the numbers into the equations 4: solve 5: write your solution statement that includes initial energy and final energy added you so much!

Answers: 2

Answer

Physics, 23.06.2019 01:30

Listed following are various physical situations that describe how light interacts with matter. match these to the appropriate category. 1) transmission? -visible light meets clear glass -visible light does not pass through a black wall -red light hits a red sweatshirt -light comes from your computer screen -cell phone signals pass through walls -blue light hits a red sweatshirt -white light hits a white piece of paper -light comes from a light bulb

Answers: 1

Answer

Physics, 23.06.2019 01:30

"if the pressure acting on an ideal gas at constant temperature is tripled, its volume isa) reduced to one-third.b) increased by a factor of three.c) increased by a factor of two.d) reduced to one-half"

Answers: 2

Answer

Physics, 23.06.2019 01:30

Energy transformations that involve one transformation from one type of energy to another are called transformations.

Answers: 1

Answer

You know the right answer?

In making the determination that bullets, shells, or cartridge cases were fired from a specific weap...

Questions