Physics, 14.02.2020 03:46 cece4874

A shell of mass 10 kg is shot upward with an initial velocity of 200 m/sec. The magnitude of the force on the shell due to air resistance is v/20.
(a) When will the shell reach its maximum height above the ground? What is the maximum height? Assume the acceleration due to gravity to be 9.81 m/s^2.

Answers: 1

Show answers

Answers

Answer from: 544620

A. 16.49 s.

B. 1536 m.

Explanation:

Equation:

dv/dt + v/40 = −g

Where v(0)=200.

Integrating,

v(t) = e^(−t/40) * [200+40*g] −

40g.

At the maximum height, the object's final velocity = 0

Therefore,

solving for t,

t = −40 * ln (40g)/(200+40g)

= 16.49 s

Remember,

v = dh/dt

Integrating,

v = dh/dt

= e^(−t/40) * (200+40*g) - 40*g

h(t) = 40 * (200) + 402*g − 40*(g*t) − e^(−t/40) * (40*(200)+402*g)

= 1536 m.

Answer from: Quest

it takes about 30 days for it to break down

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 22.06.2019 15:30

To understand the behavior of the electric field at the surface of a conductor, and its relationship to surface charge on the conductor. a conductor is placed in an external electrostatic field. the external field is uniform before the conductor is placed within it. the conductor is completely isolated from any source of current or charge. part a: which of the following describes the electric field inside this conductor? it is in the same direction as the original external field.it is in the opposite direction from that of the original external field.it has a direction determined entirely by the charge on its surface.it is always zero. part b: the charge density inside the conductor is: 0non-zero; but uniformnon-zero; non-uniforminfinite part c: assume that at some point just outside the surface of the conductor, the electric field has magnitude e and is directed toward the surface of the conductor. what is the charge density η on the surface of the conductor at that point? express your answer in terms of e and ϵ0

Answers: 1

Answer

Physics, 22.06.2019 18:00

Acid precipitation chemically weathering a 5.0-kg limestone rock . which coukd be the result ?

Answers: 1

Answer

Physics, 22.06.2019 18:30

Aballoon is rising vertically upwards at a velocity of 10m/s. when it is at a height of 45m from the ground, a parachute bails out from it. after 3s he opens his parachute and decelerates ata a constant rate 5m/s.when. (a) what was the height of the parachutist above the ground when he opened his parachute? (b)how far is the parachutist from the balloon at t=3s? (c)with what velocity does the parachutist hit the ground? (d)after how long does the parachutist hit the ground after his exist from the balloon?

Answers: 3

Answer

Physics, 23.06.2019 00:00

You can melt ice by applying pressure because the solid/liquid line has a slope.

Answers: 3

Answer

You know the right answer?

A shell of mass 10 kg is shot upward with an initial velocity of 200 m/sec. The magnitude of the for...

Questions