Physics, 17.01.2020 23:31 punchbug007

What impacts the amount of potential energy?

velocity (speed) of the object.
mass and height of the object.
mass of the object.
height of the object.

Answers: 1

Show answers

Answers

Answer from: angehtjgdb

Mass and height of the object.

Explanation:

The Mass and height of the object impacts the amount of potential energy. Potential energy is the energy possessed by a body by virtue of its position. An object launched in the air possesses potential energy since it covers a particular height(h) between the ground level and the maximum height. The body is also the influence of gravitational force (g)

According to PE formula

PE = mass × acceleration due to gravity × height

Answer from: Quest

explanation:

v=uf/(u-f)

= 5.-10/(5+10) convex lens has negative focal length

An object is located 5.0 cm from a convex lens. the lens focuses light at a distance of 10.0 cm. wha

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Another question on Physics

Physics, 21.06.2019 20:30

Aball is thrown straight up into the air with a speed of 21 m/s. if the ball has a mass of 0.1 kg, how high does the ball go? acceleration due to gravity is g = 9.8 m/s^2. a. 22.5 m b. 20.0 m c. 25.0 m d. 17.5 m

Answers: 2

Answer

Physics, 22.06.2019 05:30

Thomas his older brothers, who own a junk yard, on the weekends to earn extra money. he likes to them push broken-down cars to the back of the junk yard because it makes him feel strong. last saturday, they pushed three cars with different weights, and he noticed he used different amounts of force for each one. the cars were the following weights: white car: 2,700 kg red car: 1,500 kg blue car: 2,100 kg think about how much force is needed to move each car. which correctly lists the cars in order from the most to least amount of force needed to move them? a) white, blue, red b) blue, red, white c) red, white, blue d) white, red, blue

Answers: 2

Answer

Physics, 22.06.2019 07:30

Some material consisting of a collection of microscopic objects is kept at a high temperature. a photon detector capable of detecting photon energies from infrared through ultraviolet observes photons emitted with energies of 0.3 ev, 0.5 ev, 0.8 ev, 2.0ev, 2.5ev, and 2.8ev. these are the only photon energies observed. (a) draw and label a possible energy-level diagram for one of the microscopic objects, which has four bound states. on the diagram, indicate the transitions corresponding to the emitted photons. explain briefly. (b) would a spring–mass model be a good model for these microscopic objects? why or why not? (c) the material is now cooled down to a very low temperature, and the photon detector stops detecting photon emissions. next, a beam of light with a continuous range of energies from infrared through ultraviolet shines on the material, and the photon detector observes the beam of light after it passes through the material. what photon energies in this beam of light are observed to be significantly reduced in intensity (“dark absorption lines”)? explain briefly.

Answers: 3

Answer

Physics, 22.06.2019 15:30

The radius of a sphere is increasing at a rate of 9 cm/ sec. find the radius of the sphere when the volume and the radius of the sphere are increasing at the same numerical rate.

Answers: 1

Answer

You know the right answer?

What impacts the amount of potential energy?

velocity (speed) of the object.
ma...

Questions