Physics, 29.10.2019 02:31 isaiyt

Humans have nearly 80 different kinds of organs. each organ serves a specialized
purpose in the body. for example, the brain serves as the control center of the body.
what do single-celled organisms have that serve the same purpose as organs?

o molecules

organelles

tissues

atoms

Answers: 1

Show answers

Answers

Answer from: shiahdiah

The correct answer is B. Organelles.

Explanation

An organelles are units that are part of the unicellular organism or a cell. Each of these units has various specific functions provide structure to the organism of which they are part. According to the above, organelles are the component of unicellular organisms that have the same purpose of organs in multicellular organisms, because their functions contribute to the life of organisms. So, the correct answer is B. Organelles.

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

a is the best answer your welcome

Another question on Physics

Physics, 21.06.2019 22:50

An electron and a proton have the same kinetic energy upon entering a region of constant magnetic field and their velocity vectors are perpendicular to the magnetic field. suppose the magnetic field is strong enough to allow the particles to circle in the field. note: you'll need to look up the masses for an electron and proton. 1) what is the ratio of the radii of their circular paths rp/re?

Answers: 3

Answer

Physics, 22.06.2019 02:10

How is coal extracted from mountaintop removal mines? a. dynamite is used to create underground tunnels where miners go to extract the coal. b. dynamite is used to break apart rocks and then draglines are used to remove the broken rock and reach the coal. c. coal in mountaintops is extracted by digging strips in the landscape to reach the coal. d. placer deposits in mountain river bottoms are removed by

Answers: 2

Answer

Physics, 22.06.2019 08:30

Pl asaaap ! match the term to the correct description. a type of wave that transfers energy where the particles in the medium move perpendicular to the direction in which the energy is traveling. a type of wave that transfers energy where the particles in the medium move parallel to the direction in which the energy is traveling. movement that is back and forth, like an equal sign = a type of wave that transfers energy where the particles in the medium move in a circle motion while the energy travels left or right. movement that is like a t transfers energy from one location to another 1. wave 2. parallel movement 3. perpendicular movement 4. transverse wave 5. longitudinal wave 6. surface wave

Answers: 1

Answer

Physics, 22.06.2019 10:30

You are given two vectors a⃗ =−3.00ι^ 5.00j^ and b⃗ =5.00ι^ 2.00j^. let the counterclockwise angles be positive.

Answers: 3

Answer

You know the right answer?

Humans have nearly 80 different kinds of organs. each organ serves a specialized
purpose in th...

Questions