Physics, 05.08.2019 18:10 haven765

Adouble-slit experiment is set up using red light (λ = 706 nm). a first order bright fringe is seen at a given location on a screen. what wavelength of visible light (between 380 nm and 750 nm) would produce a dark fringe at the identical location on the screen? λ =

Answers: 2

Show answers

Answers

Answer from: Queen1601

λ = 470.66 nm

Explanation:

for bright fringe $y_m = \frac{m\lambda D}{d}$

D= distance between slit and screen

d= distance between the slits

for first order bright fringe m = 1,

$y_1 = \frac{1\lambda D}{d}$

$y_1 = {706*D}{d}$

for dark fringe,we have

$y_m = {(m + 1/2)\lambda D}{d}$

Now to get the dark fringes at the same location we should have;

(706)D/d = (m + 1/2)λD/d

put m = 1

(1 + 1/2)λ = (706)

λ = 470.66 nm

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

when two balls of the different masses are dropped from equal height, they reach the ground at the same time .this is because they experience the same acceleration.

the acceleration is independent of mass.

thus when they are dropped they will always maintain the same velocity and travel the same distance (neglect air resistance of course) at the same time.

Another question on Physics

Physics, 21.06.2019 15:10

Four objects are being tested to see how they are affected by fluid friction. object w has a surface area of 4.5 cm2, object x has a surface area of 2.5 cm2, object y has a surface area of 6.2 cm2, and object z has a surface area of 3 cm2. which object would experience the most fluid friction?

Answers: 3

Answer

Physics, 22.06.2019 05:10

What is the electric force acting between two charges of -0.0045 c and -0.0025 c that are 0.0060 m apart? use fe=kq1q2/r^2 and k = 9.00 x 10^9 n*m^2/c^2 a. 1.7 x 10^7 n b. -1.7 x 10^7 n c. -2.8 x 10^9 n d. 2.8 x 10^9 n

Answers: 1

Answer

Physics, 22.06.2019 06:30

The coulomb's law explains which of the following? select all the force between two charged objects is inversely proportional to the charge on each object. the force between two charged objects is directly proportional to the charge on each object. the force between two charged objects is directly proportional to the distance separating them. the force between two charged objects is inversely proportional to the square of the distance separat coulomb's law is similar to newton's 2nd law. if the force between two objects is f and the charge on both objects is doubled, the new force between the would now be 2f. if the force between two objects is 2f and the distance separating them is doubled, the new force between the objects would now o the be zf.

Answers: 3

Answer

Physics, 22.06.2019 10:00

(a) calculate the number of electrons in a small, electrically neutral silver pin that has a mass of 10.0 g. silver has 47 electrons per atom, and its molar mass is 107.87 g/mol. (b) imagine adding electrons to the pin until the negative charge has the very large value 1.00 mc. how many electrons are added for every 109 electrons already present

Answers: 3

Answer

You know the right answer?

Adouble-slit experiment is set up using red light (λ = 706 nm). a first order bright fringe is seen...

Questions