Physics, 27.01.2020 20:31 kkeith121p6ujlt

Imagine a raindrop starting from rest in a cloud 2 km in the air. if it fell with no air friction at all, it would accelerate toward the ground with gravitational acceleration of 9.8m/s2. what would the speed of the drop be when it reached the ground? convert your answer into miles per hour.
1) 212 mph
2) 433 mph
3) 774 mph
4) 72.5 mph

Answers: 3

Show answers

Answers

Answer from: Nobleufia

2) 433 mph

Explanation:

The final velocity of the raindrop as it reaches the ground can be found by using the equation for a uniformly accelerated motion:

v^2 = u^2 + 2ad

where

v is the final velocity

u = 0 is the initial velocity (the raindrop starts from rest)

a = g = 9.8 m/s^2 is the acceleration due to gravity

d = 2 km = 2000 m is the distance covered

Solving for v,

$v=\sqrt{u^2 +2gd}=\sqrt{0^2+2(9.8 m/s^2)(2000)}=198 m/s$

And keeping in mind that

1 mile = 1609 metres

1 hour = 3600 s

The speed converted into miles per hour is

$v=198 \frac{m}{s}\cdot \frac{3600 s/h}{1609 m/mi}=433 mph$

Answer from: Quest

Acetic acid /əˈsiːtɪk/, systematically named ethanoic acid /ˌɛθəˈnoʊɪk/, is a colourless liquid organic compound with the chemical formula ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called glacial acetic acid. vinegar is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to polyvinyl acetate and cellulose acetate. it is classified as a weak acid since it only partially dissociates in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7 3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366 chemblchembl539 chemspider171 drugbankdb03166 echa infocard100.000.528ec number200-580-7e numbere260 (preservatives)gmelin reference1380iuphar/bps1058keggd00010 meshacetic+acidpubchem cid176rtecs numberaf1225000uniiq40q9n063p un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4) key: qtbsbxvteameqo-uhfffaoysa-n smilescc(o)=o

Answer from: Quest

answer;

d. are made mostly of liquid

explanation;

-the general composition and structure planets includes; they have a thick gas and liquid layer covering a small,solid core. mostly the gases are hydrogen and helium atmosphere and layers of liquid hydrogen. for instance neptune and uranus are examples of the outer planets, they have a core covered by ice and ammonia.

-neptune's atmosphere is hydrogen and helium with a bit of methane so there is no oxygen to breath and the interior is made up of frozen water and ammonia with a rock and iron core. thus, there is no liquid water or solid surface to survive.

Another question on Physics

Physics, 21.06.2019 20:50

An airplane flies eastward and always accelerates at a constant rate. at one position along its path it has a velocity of 34.3 m/s, it then flies a further distance of 40100 m and afterwards its velocity is 47.5 m/s. find the airplane\'s acceleration and calculate how much time elapses while the airplane covers those 40100 m.

Answers: 1

Answer

Physics, 22.06.2019 10:20

Electromagnetic induction. a coil of wire contains n turns and has an electrical resistance r. the radius of each turn is a. initially, inside the coil there exists a uniform magnetic field of magnitude b0 parallel to the axis of the coil. the magnetic field is then reduced slowly. the current induced in the coil is i. how long does it take for the magnitude of the uniform field to drop to zero?

Answers: 1

Answer

Physics, 22.06.2019 15:30

The radius of an atom is closest in size to a

Answers: 2

Answer

Physics, 23.06.2019 02:00

Which of the following is the largest disadvantage of about half of the electricity in the united states comes from burning

Answers: 2

Answer

You know the right answer?

Imagine a raindrop starting from rest in a cloud 2 km in the air. if it fell with no air friction at...