According to the doppler effect, which statement is true about a sound as it approaches you and then moves away.

a) as the source approaches you, the sound waves are compressed so the pitch of the noise increases.
b) the pitch of the sound remains the same the entire time, regardless of the direction of the source.
c) as the source moves away from you the sound waves are compressed so the pitch of the noise increases.
d) as the source approaches you, the sound waves are stretched relative to the individual so the pitch of the noise decreases.

As the source approaches you, the sound waves are compressed, so
the pitch of the sound is higher than what the source is actually emitting.

Then, after it passes you and begins moving away, the sound waves
are stretched, so the pitch of the sound is lower than what the source
is actually emitting.

Acetic acid  /əˈsiːtɪk/, systematically named  ethanoic acid  /ˌɛθəˈnoʊɪk/, is a colourless liquid  organic compound  with the  chemical formula  ch3cooh (also written as ch3co2h or c2h4o2). when undiluted, it is sometimes called  glacial acetic acid.  vinegar  is no less than 4% acetic acid by volume, making acetic acid the main component of vinegar apart from water. acetic acid has a distinctive sour taste and pungent smell. in addition to household vinegar, it is mainly produced as a precursor to  polyvinyl acetate  and  cellulose acetate. it is classified as a  weak acid  since it only partially  dissociates  in solution, but concentrated acetic acid is corrosive and can attack the skin.acetic acidnamespreferred iupac nameacetic acidsystematic iupac nameethanoic acidother namesvinegar (when dilute); hydrogen acetate; methanecarboxylic acid[1][2]identifierscas number64-19-7  3d model (jsmol)interactive image3dmetb00009 reference506007chebichebi: 15366  chemblchembl539  chemspider171  drugbankdb03166  echa infocard100.000.528ec number200-580-7e numbere260  (preservatives)gmelin reference1380iuphar/bps1058keggd00010  meshacetic+acidpubchem  cid176rtecs numberaf1225000uniiq40q9n063p  un number2789inchiinchi=1s/c2h4o2/c1-2(3)4/h1h3,(h,3,4)  key:   qtbsbxvteameqo-uhfffaoysa-n  smilescc(o)=o