Chemistry, 25.07.2019 23:30 blessing5266

Calculate the ph of 0.726 m anilinium hydrochloride (c6h5nh3cl) solution in water, given that kb for aniline is 3.83 x 10-4.

Answers: 1

Show answers

Answers

Answer from: psychocatgirl1

The pH of 0.726 M anilinium hydrochloride solution in water is 5.36.

C₆H₅NH₃Cl dissociates completely in water according to the following equation.

C₆H₅NH₃Cl(aq) ⇒ C₆H₅NH₃⁺(aq) + Cl⁻(aq)

Cl⁻ is a very weak base so it can't react with water, whereas C₆H₅NH₃⁺ reacts with water according to the following acid equation.

C₆H₅NH₃⁺(aq) + H₂O(l) ⇒ C₆H₅NH₂(aq) + H₃O⁺

Given Kb for C₆H₅NH₂ is 3.83 × 10⁻⁴, we can calculate Ka for C₆H₅NH₃⁺ using the following expression.

$Ka \times Kb = Kw\\\\Ka = \frac{Kw}{Kb} = \frac{1.00 \times 10^{-14} }{3.83 \times 10^{-4} } = 2.61 \times 10^{-11}$

Given the concentration of C₆H₅NH₃⁺ (Ca) is 0.726 M and the acid dissociation constant (Ka) is 2.61 × 10⁻¹¹, we can calculate [H⁺] using the following expression.

$[H^{+} ] = \sqrt{Ka \times Ca } = \sqrt{(2.61 \times 10^{-11} ) \times 0.726 } = 4.35 \times 10^{-6} M$

The pH of the solution is:

$pH = -log[H^{+} ] = -log (4.35 \times 10^{-6}) = 5.36$

The pH of 0.726 M anilinium hydrochloride solution in water is 5.36.

Learn more: link

Calculate the pH of 0.726 M anilinium hydrochloride (C₆H₅NH₃Cl) solution in water, given that Kb for aniline is 3.83 × 10⁻⁴.

Answer from: liltonio

First, we have to get Ka:

when Ka = Kw / Kb and we have Kb = 3.83 x 10^-4 & Kw = 1 x 10^-14

∴Ka = (1 x 10^-14) / (3.83 x 10^-4)

= 2.6 x 10^-11

according to the reaction equation:

by using ICE table:

C6H5NH3+ + H2O ↔ C6H5NH2 + H3O+

initial 0.726 0 0

change -X +X +X

Equ (0.726 -X) X X

when Ka = [C6H5NH2][H3O+]/[C6H5NH3+]

by substitution:

2.6 x 10^-11 = X*X / (0.726 -X) by solving for X

∴X = 4.3 x 10^-6

when [H3O+] = X = 4.3 x 10^-6

∴PH = -㏒[H3O+]

= -㏒(4.3 x 10^-6)

= 5.4

Answer from: Quest

jdjxnbfb

explanation:

jjfnc fdnxnxx

Answer from: Quest

the answer is a for sure mark brainliest i had got this right on usatestprep

Another question on Chemistry

Chemistry, 22.06.2019 02:00

If you add 10ml of hot water to 10ml of cold water and the change in tempature 8°c calculate how much energy is gained by the cold water

Answers: 1

Answer

Chemistry, 22.06.2019 06:00

24. a sports ball is inflated to an internal pressure of 1.85 atm at room temperature (25 °c). if the ball is then played with outside where the temperature is 7.5 °c, what will be the new pressure of the ball? assume the ball does not change in volume nor does any air leak from the ball a) 0.555 atm b) 1.74 atm c) 1.85 atm d) 1.97 atm

Answers: 2

Answer

Chemistry, 22.06.2019 08:00

Identify a strong intermolecular force of attraction between an alcohol

Answers: 1

Answer

Chemistry, 22.06.2019 09:50

When balancing a chemical equation:

Answers: 1

Answer

You know the right answer?

Calculate the ph of 0.726 m anilinium hydrochloride (c6h5nh3cl) solution in water, given that kb for...