subject
Chemistry, 09.10.2021 01:00 animaemaster

Balance Ni(NO3)2+Na2CrO4=NiCrO4+Na(NO3)2

ansver
Answers: 1

Another question on Chemistry

question
Chemistry, 22.06.2019 04:00
4. absorption has the highest risk of overdose due to increased potency. a. rectal b. oral c. transdermal d. intranasal
Answers: 2
question
Chemistry, 22.06.2019 04:30
Which is a chemical property of iron? a. it forms iron oxide (rust) when exposed to moisture and air. b. it is a gray–black metal that is hard to the touch. c. it has a melting point of 2795°f (1536°c). d. it is a good conductor of heat
Answers: 2
question
Chemistry, 22.06.2019 15:00
What energy is it when you flip on a switch on a lamp
Answers: 1
question
Chemistry, 22.06.2019 21:50
If e is the symbol for an element, which two of the following symbols represent isotopes of the same element? 1. e2. e3. ea.1 and 2c.1 and 4b.3 and 4d.2 and 3
Answers: 2
You know the right answer?
Balance Ni(NO3)2+Na2CrO4=NiCrO4+Na(NO3)2...
Questions
Questions on the website: 13722360