Consider the reaction: NaNO3(s)+H2SO4(l)NaSO4(s)+HNO3 delta H= 21.2kj How much heat is absorbed by the reaction system to convert 100g of NaNO3 into NaHSO4(s)?

your parents i think this could be it

b.false that your answer

chemical changes occur when a substance combines with another to form a new substance, called chemical synthesis or, alternatively, chemical decomposition into two or more different substances. these processes are called chemical reactions and, in general, are not reversible except by further chemical reactions. some reactions produce heat and are called exothermic reactions and others may require heat to enable the reaction to occur, which are called endothermic reactions. understanding chemical changes is a major part of the science of chemistry.

the pseudoscience are like beliefs, theories, or like practices that are considered scientific