Cunoscand urmatoarele date termodinamice CH4(g) +2O2(g)= CO2(g)+2H2O(g) ΔH1=-203 kj/mol
4HCl(g) + O2= 2H2O(g) +2Cl2(g) ΔH2=-116kj/mol
CH3Cl(g)+H2O=CH3OH(g)+HCl(g) ΔH3=-3kj/mol
CH3Oh(g) +3O2(g)=2CO2+4H2O ΔH4=-1300kj/mol

calculeze variatia de entalpie in conditii standard pt reactia CH4(g)+Cl2(g)=CH3Cl(g)

Achemist has dissolved a certain substance in water. the chemist knows that more of the substance could be dissolved into the water before it stops dissolving. therefore

In order to complete this lab. you will need to be familiar with some common chemistry terms. complete the chemical change puzzle and list the relevant terms and their meaning below a.rectant b.product c.supernate

Be sure to answer all parts. the following equilibrium constants were determined at 1123 k: c(s) + co2(g) ⇌ 2co(g) k'p = 1.30 × 1014 co(g) + cl2(g) ⇌ cocl2(g) k''p = 6.00 × 10−3 calculate the equilibrium constant at 1123 k for the reaction: c(s) + co2(g) + 2cl2(g) ⇌ 2cocl2(g) 4.68 × 10 9 (enter your answer in scientific notation.) write the equilibrium constant expression, kp: