Draw the alcohol that is the product of the reduction of 3-methylpentanal.

The product from the reduction reaction is

CH3-CH2-CH(CH3)-CH2-CH2OH

IUPAC name; 3- Methylpentan-1-ol

Explanation:

Since oxidation is simply the addition of oxygen to a compound and reduction is likewise the addition of hydrogen to a compound.

Therefore, hydrogen is added onto the carbon atom adjacent to oxygen in 3- methyl pentanal

CH3 CH2 CHCH3 CH2 CHO thereby -CHO( aldehyde functional group) are reduced to CH2OH ( Primary alcohol) which gives;

3-methylpenta-1-ol .

The structure of the product is:

CH3-CH2-CH(CH3)-CH2-CH2OH

periodic trends is an atom that gets larger as the number of electronic shells increase, the radius of atoms increases as you go down a certain group in the periodic table of elements. in general, the size of an atom will decrease as you move from left to right of a certain period.