Does anyone knows the skeletal structure for this one?

CH3-CH(CH3)-CH2-CH2-CH2-C(CH3)2-CH(CH3)-CH3

it's named

2,3,3,7-tertamethyloctane

rising sea temps which are causing coral reefs to bleach and die out

glaciers are melting causing sea levels to rise wgich could flood out land

explanation:

a axis of a graph is a color or shade so we can all go outside and have a party so we can eat   some grilled cheese sammiches and broccoli and have some ugly fun times

i don't know why i put this, i know its not the i was just bored : p

delete this answer while you can